C10H15F3S — CID 142207427
ethene;(2E,4E)-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexa-2,4-diene (PubChem CID 142207427) has the molecular formula C10H15F3S and a molecular weight of 224.29 g/mol. Its IUPAC name is ethene;(2E,4E)-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexa-2,4-diene.
| Compound Name | ethene;(2E,4E)-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexa-2,4-diene |
|---|---|
| PubChem CID | 142207427 |
| Molecular Formula | C10H15F3S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | ethene;(2E,4E)-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexa-2,4-diene |
| SMILES | C=C.CS/C(C)=C/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C8H11F3S.C2H4/c1-6(8(9,10)11)4-5-7(2)12-3;1-2/h4-5H,1-3H3;1-2H2/b6-4+,7-5+; |
| InChIKey | AGADNJINQSZWQC-GWDFKRKCSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|