C11H18F2S — CID 143267537
(3E)-3-[difluoro(propylsulfanyl)methyl]penta-1,3-diene;ethene (PubChem CID 143267537) has the molecular formula C11H18F2S and a molecular weight of 220.33 g/mol. Its IUPAC name is (3E)-3-[difluoro(propylsulfanyl)methyl]penta-1,3-diene;ethene.
| Compound Name | (3E)-3-[difluoro(propylsulfanyl)methyl]penta-1,3-diene;ethene |
|---|---|
| PubChem CID | 143267537 |
| Molecular Formula | C11H18F2S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (3E)-3-[difluoro(propylsulfanyl)methyl]penta-1,3-diene;ethene |
| SMILES | C=C.C=C/C(=C\C)C(F)(F)SCCC |
| InChI | InChI=1S/C9H14F2S.C2H4/c1-4-7-12-9(10,11)8(5-2)6-3;1-2/h5-6H,2,4,7H2,1,3H3;1-2H2/b8-6+; |
| InChIKey | XXWIPFBHTJLVIE-WVLIHFOGSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|