C8H13FS — CID 138465199
(2Z,4Z)-2-fluoro-3-methylsulfanylhepta-2,4-diene (PubChem CID 138465199) has the molecular formula C8H13FS and a molecular weight of 160.26 g/mol. Its IUPAC name is (2Z,4Z)-2-fluoro-3-methylsulfanylhepta-2,4-diene.
| Compound Name | (2Z,4Z)-2-fluoro-3-methylsulfanylhepta-2,4-diene |
|---|---|
| PubChem CID | 138465199 |
| Molecular Formula | C8H13FS |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2Z,4Z)-2-fluoro-3-methylsulfanylhepta-2,4-diene |
| SMILES | CC/C=C\C(SC)=C(/C)F |
| InChI | InChI=1S/C8H13FS/c1-4-5-6-8(10-3)7(2)9/h5-6H,4H2,1-3H3/b6-5-,8-7- |
| InChIKey | QVVWEHMFZLFXMO-ISTTXYCBSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|