About 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene
2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene (PubChem CID 123824784) has the molecular formula C7H8F2S
and a molecular weight of 162.20 g/mol. Its IUPAC name is 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene.
Analyze 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene?
The IUPAC name of 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene (CID 123824784) is 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene.
What is the SMILES notation for 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene?
The canonical SMILES for 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene is CSC1=C(F)C=CCC1F.
What is the InChIKey of 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene?
The InChIKey is ZTUKLNOKRZGPJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2S/c1-10-7-5(8)3-2-4-6(7)9/h2-3,6H,4H2,1H3.
What are the key properties of 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene?
2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene has a molecular weight of 162.20 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-1-methylsulfanylcyclohexa-1,3-diene is sourced from PubChem (CID 123824784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).