C13H19ClS — CID 167105480
(3Z,6Z)-7-(3-chlorobut-1-en-2-ylsulfanyl)-5,6-dimethylhepta-1,3,6-triene (PubChem CID 167105480) has the molecular formula C13H19ClS and a molecular weight of 242.81 g/mol. Its IUPAC name is (3Z,6Z)-7-(3-chlorobut-1-en-2-ylsulfanyl)-5,6-dimethylhepta-1,3,6-triene.
| Compound Name | (3Z,6Z)-7-(3-chlorobut-1-en-2-ylsulfanyl)-5,6-dimethylhepta-1,3,6-triene |
|---|---|
| PubChem CID | 167105480 |
| Molecular Formula | C13H19ClS |
| Molecular Weight | 242.81 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (3Z,6Z)-7-(3-chlorobut-1-en-2-ylsulfanyl)-5,6-dimethylhepta-1,3,6-triene |
| SMILES | C=C/C=C\C(C)/C(C)=C\SC(=C)C(C)Cl |
| InChI | InChI=1S/C13H19ClS/c1-6-7-8-10(2)11(3)9-15-13(5)12(4)14/h6-10,12H,1,5H2,2-4H3/b8-7-,11-9- |
| InChIKey | SEHNADHPFYIGBC-JCBKOVKPSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|