C12H20S — CID 134321964
(4E,6Z)-4-ethylsulfanyl-2,3-dimethylocta-1,4,6-triene (PubChem CID 134321964) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is (4E,6Z)-4-ethylsulfanyl-2,3-dimethylocta-1,4,6-triene.
| Compound Name | (4E,6Z)-4-ethylsulfanyl-2,3-dimethylocta-1,4,6-triene |
|---|---|
| PubChem CID | 134321964 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (4E,6Z)-4-ethylsulfanyl-2,3-dimethylocta-1,4,6-triene |
| SMILES | C=C(C)C(C)/C(=C\C=C/C)SCC |
| InChI | InChI=1S/C12H20S/c1-6-8-9-12(13-7-2)11(5)10(3)4/h6,8-9,11H,3,7H2,1-2,4-5H3/b8-6-,12-9+ |
| InChIKey | RDZRMAJLWWCLKG-ZHAQITPWSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|