C11H17FS — CID 139457569
1-fluoro-6-methyl-2-(propylsulfanylmethyl)cyclohexa-1,3-diene (PubChem CID 139457569) has the molecular formula C11H17FS and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-fluoro-6-methyl-2-(propylsulfanylmethyl)cyclohexa-1,3-diene.
| Compound Name | 1-fluoro-6-methyl-2-(propylsulfanylmethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139457569 |
| Molecular Formula | C11H17FS |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-fluoro-6-methyl-2-(propylsulfanylmethyl)cyclohexa-1,3-diene |
| SMILES | CCCSCC1=C(F)C(C)CC=C1 |
| InChI | InChI=1S/C11H17FS/c1-3-7-13-8-10-6-4-5-9(2)11(10)12/h4,6,9H,3,5,7-8H2,1-2H3 |
| InChIKey | IWMKEBGZWHQSRQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|