C12H21ClS — CID 130182667
chloro-[(3E,4Z)-3-ethylidene-2-methylhepta-4,6-dien-2-yl]-dimethyl-λ4-sulfane (PubChem CID 130182667) has the molecular formula C12H21ClS and a molecular weight of 232.82 g/mol. Its IUPAC name is chloro-[(3E,4Z)-3-ethylidene-2-methylhepta-4,6-dien-2-yl]-dimethyl-λ4-sulfane.
| Compound Name | chloro-[(3E,4Z)-3-ethylidene-2-methylhepta-4,6-dien-2-yl]-dimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 130182667 |
| Molecular Formula | C12H21ClS |
| Molecular Weight | 232.82 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | chloro-[(3E,4Z)-3-ethylidene-2-methylhepta-4,6-dien-2-yl]-dimethyl-λ4-sulfane |
| SMILES | C=C/C=C\C(=C/C)C(C)(C)S(C)(C)Cl |
| InChI | InChI=1S/C12H21ClS/c1-7-9-10-11(8-2)12(3,4)14(5,6)13/h7-10H,1H2,2-6H3/b10-9-,11-8+ |
| InChIKey | DWJRURWKJLUBGX-LMMFKTOUSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|