C11H18S — CID 528331
1-(3-methylbutylsulfanylmethyl)cyclopenta-1,3-diene (PubChem CID 528331) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is 1-(3-methylbutylsulfanylmethyl)cyclopenta-1,3-diene.
| Compound Name | 1-(3-methylbutylsulfanylmethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 528331 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(3-methylbutylsulfanylmethyl)cyclopenta-1,3-diene |
| SMILES | CC(C)CCSCC1=CC=CC1 |
| InChI | InChI=1S/C11H18S/c1-10(2)7-8-12-9-11-5-3-4-6-11/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | NXPWMLYKOOSTEU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|