C11H13FS — CID 163415117
(3Z)-3-[(2E)-2-fluoro-3-methylpenta-2,4-dienylidene]-5-methylthiophene (PubChem CID 163415117) has the molecular formula C11H13FS and a molecular weight of 196.29 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-fluoro-3-methylpenta-2,4-dienylidene]-5-methylthiophene.
| Compound Name | (3Z)-3-[(2E)-2-fluoro-3-methylpenta-2,4-dienylidene]-5-methylthiophene |
|---|---|
| PubChem CID | 163415117 |
| Molecular Formula | C11H13FS |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3Z)-3-[(2E)-2-fluoro-3-methylpenta-2,4-dienylidene]-5-methylthiophene |
| SMILES | C=C/C(C)=C(F)\C=C1\C=C(C)SC1 |
| InChI | InChI=1S/C11H13FS/c1-4-8(2)11(12)6-10-5-9(3)13-7-10/h4-6H,1,7H2,2-3H3/b10-6-,11-8+ |
| InChIKey | ADSZGZIRKNSSKK-YANFREPOSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|