C10H17ClS — CID 91549283
2-chloro-5-(ethylsulfanylmethyl)hepta-2,4-diene (PubChem CID 91549283) has the molecular formula C10H17ClS and a molecular weight of 204.77 g/mol. Its IUPAC name is 2-chloro-5-(ethylsulfanylmethyl)hepta-2,4-diene.
| Compound Name | 2-chloro-5-(ethylsulfanylmethyl)hepta-2,4-diene |
|---|---|
| PubChem CID | 91549283 |
| Molecular Formula | C10H17ClS |
| Molecular Weight | 204.77 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-chloro-5-(ethylsulfanylmethyl)hepta-2,4-diene |
| SMILES | CCSCC(=CC=C(C)Cl)CC |
| InChI | InChI=1S/C10H17ClS/c1-4-10(8-12-5-2)7-6-9(3)11/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | GVYPFUDJMATKOP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.77 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|