C9H12ClFS — CID 142221692
(3Z)-4-chloro-3-(ethylsulfanylmethyl)-2-fluorohexa-1,3,5-triene (PubChem CID 142221692) has the molecular formula C9H12ClFS and a molecular weight of 206.71 g/mol. Its IUPAC name is (3Z)-4-chloro-3-(ethylsulfanylmethyl)-2-fluorohexa-1,3,5-triene.
| Compound Name | (3Z)-4-chloro-3-(ethylsulfanylmethyl)-2-fluorohexa-1,3,5-triene |
|---|---|
| PubChem CID | 142221692 |
| Molecular Formula | C9H12ClFS |
| Molecular Weight | 206.71 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | (3Z)-4-chloro-3-(ethylsulfanylmethyl)-2-fluorohexa-1,3,5-triene |
| SMILES | C=C/C(Cl)=C(/CSCC)C(=C)F |
| InChI | InChI=1S/C9H12ClFS/c1-4-9(10)8(7(3)11)6-12-5-2/h4H,1,3,5-6H2,2H3/b9-8+ |
| InChIKey | LQVOWYQKMDEXLG-CMDGGOBGSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|