C15H20N2O6 — CID 134975315
ethyl 4-(2-ethoxycarbonylprop-2-enyl)-2,6-dimethoxypyrimidine-5-carboxylate (PubChem CID 134975315) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is ethyl 4-(2-ethoxycarbonylprop-2-enyl)-2,6-dimethoxypyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(2-ethoxycarbonylprop-2-enyl)-2,6-dimethoxypyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 134975315 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | ethyl 4-(2-ethoxycarbonylprop-2-enyl)-2,6-dimethoxypyrimidine-5-carboxylate |
| SMILES | C=C(Cc1nc(OC)nc(OC)c1C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H20N2O6/c1-6-22-13(18)9(3)8-10-11(14(19)23-7-2)12(20-4)17-15(16-10)21-5/h3,6-8H2,1-2,4-5H3 |
| InChIKey | PBFVYOOTJJWSKA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|