C12H16N2O4 — CID 121015747
ethyl 2,4-dimethoxy-6-prop-2-enylpyrimidine-5-carboxylate (PubChem CID 121015747) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl 2,4-dimethoxy-6-prop-2-enylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2,4-dimethoxy-6-prop-2-enylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 121015747 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | ethyl 2,4-dimethoxy-6-prop-2-enylpyrimidine-5-carboxylate |
| SMILES | C=CCc1nc(OC)nc(OC)c1C(=O)OCC |
| InChI | InChI=1S/C12H16N2O4/c1-5-7-8-9(11(15)18-6-2)10(16-3)14-12(13-8)17-4/h5H,1,6-7H2,2-4H3 |
| InChIKey | SCMWOWYPANFEHD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|