C15H19N4O5PS — CID 134975327
(2R,5R)-2-(hydroxymethyl)-5-[6-(3-methyl-1-phosphorosobut-2-en-2-yl)sulfanylpurin-9-yl]oxolane-3,4-diol (PubChem CID 134975327) has the molecular formula C15H19N4O5PS and a molecular weight of 398.38 g/mol. Its IUPAC name is (2R,5R)-2-(hydroxymethyl)-5-[6-(3-methyl-1-phosphorosobut-2-en-2-yl)sulfanylpurin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(hydroxymethyl)-5-[6-(3-methyl-1-phosphorosobut-2-en-2-yl)sulfanylpurin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 134975327 |
| Molecular Formula | C15H19N4O5PS |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (2R,5R)-2-(hydroxymethyl)-5-[6-(3-methyl-1-phosphorosobut-2-en-2-yl)sulfanylpurin-9-yl]oxolane-3,4-diol |
| SMILES | CC(C)=C(CP=O)Sc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C(O)C1O |
| InChI | InChI=1S/C15H19N4O5PS/c1-7(2)9(4-25-23)26-14-10-13(16-5-17-14)19(6-18-10)15-12(22)11(21)8(3-20)24-15/h5-6,8,11-12,15,20-22H,3-4H2,1-2H3/t8-,11?,12?,15-/m1/s1 |
| InChIKey | SHKLFUMTXWHKJY-QPNWHGLRSA-N |
| XLogP | 1.12 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|