C13H21ClO5Si — CID 134975356
(1S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-chloro-1-hydroxy-6-oxabicyclo[3.2.1]octane-3,7-dione (PubChem CID 134975356) has the molecular formula C13H21ClO5Si and a molecular weight of 320.85 g/mol. Its IUPAC name is (1S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-chloro-1-hydroxy-6-oxabicyclo[3.2.1]octane-3,7-dione.
| Compound Name | (1S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-chloro-1-hydroxy-6-oxabicyclo[3.2.1]octane-3,7-dione |
|---|---|
| PubChem CID | 134975356 |
| Molecular Formula | C13H21ClO5Si |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (1S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-chloro-1-hydroxy-6-oxabicyclo[3.2.1]octane-3,7-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1C(=O)C(Cl)[C@]2(O)C[C@@H]1OC2=O |
| InChI | InChI=1S/C13H21ClO5Si/c1-12(2,3)20(4,5)19-9-7-6-13(17,11(16)18-7)10(14)8(9)15/h7,9-10,17H,6H2,1-5H3/t7-,9?,10?,13+/m0/s1 |
| InChIKey | APQMGKINSOTPKE-YJHLOQPRSA-N |
| XLogP | 1.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|