C13H23ClO5Si — CID 134975357
4-[tert-butyl(dimethyl)silyl]oxy-2-chloro-1,3-dihydroxy-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 134975357) has the molecular formula C13H23ClO5Si and a molecular weight of 322.86 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-chloro-1,3-dihydroxy-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-chloro-1,3-dihydroxy-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 134975357 |
| Molecular Formula | C13H23ClO5Si |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-chloro-1,3-dihydroxy-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1C2CC(O)(C(=O)O2)C(Cl)C1O |
| InChI | InChI=1S/C13H23ClO5Si/c1-12(2,3)20(4,5)19-9-7-6-13(17,11(16)18-7)10(14)8(9)15/h7-10,15,17H,6H2,1-5H3 |
| InChIKey | NDJWXMQXISFHKU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|