C8H13ClO6 — CID 134975358
methyl 2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate (PubChem CID 134975358) has the molecular formula C8H13ClO6 and a molecular weight of 240.64 g/mol. Its IUPAC name is methyl 2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate.
| Compound Name | methyl 2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134975358 |
| Molecular Formula | C8H13ClO6 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | methyl 2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(O)CC(O)C(O)C(O)C1Cl |
| InChI | InChI=1S/C8H13ClO6/c1-15-7(13)8(14)2-3(10)4(11)5(12)6(8)9/h3-6,10-12,14H,2H2,1H3 |
| InChIKey | RQACZZPVYAIELK-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|