C7H11ClO6 — CID 150342962
cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid (PubChem CID 150342962) has the molecular formula C7H11ClO6 and a molecular weight of 226.61 g/mol. Its IUPAC name is cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid.
| Compound Name | cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 150342962 |
| Molecular Formula | C7H11ClO6 |
| Molecular Weight | 226.61 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(O)C[C@@H](O)C(O)[C@H](O)C1Cl |
| InChI | InChI=1S/C7H11ClO6/c8-5-4(11)3(10)2(9)1-7(5,14)6(12)13/h2-5,9-11,14H,1H2,(H,12,13)/t2-,3?,4+,5?,7?/m1/s1 |
| InChIKey | GSBZYMWABSULDI-APVIKVHPSA-N |
| XLogP | -2.10 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.61 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|