C7H14ClO10P — CID 172767549
cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid;phosphoric acid (PubChem CID 172767549) has the molecular formula C7H14ClO10P and a molecular weight of 324.61 g/mol. Its IUPAC name is cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid;phosphoric acid.
| Compound Name | cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid;phosphoric acid |
|---|---|
| PubChem CID | 172767549 |
| Molecular Formula | C7H14ClO10P |
| Molecular Weight | 324.61 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid;phosphoric acid |
| SMILES | O=C(O)C1(O)C[C@@H](O)C(O)[C@H](O)C1Cl.O=P(O)(O)O |
| InChI | InChI=1S/C7H11ClO6.H3O4P/c8-5-4(11)3(10)2(9)1-7(5,14)6(12)13;1-5(2,3)4/h2-5,9-11,14H,1H2,(H,12,13);(H3,1,2,3,4)/t2-,3?,4+,5?,7?;/m1./s1 |
| InChIKey | MNCVGQJLNJJNNX-YXNPVRFRSA-N |
| XLogP | -3.03 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.61 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|