C7H12Cl2O6 — CID 162312714
cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid;hydrochloride (PubChem CID 162312714) has the molecular formula C7H12Cl2O6 and a molecular weight of 263.07 g/mol. Its IUPAC name is cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid;hydrochloride.
| Compound Name | cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 162312714 |
| Molecular Formula | C7H12Cl2O6 |
| Molecular Weight | 263.07 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | cis-(3S,5R)-2-chloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1(O)C[C@@H](O)C(O)[C@H](O)C1Cl |
| InChI | InChI=1S/C7H11ClO6.ClH/c8-5-4(11)3(10)2(9)1-7(5,14)6(12)13;/h2-5,9-11,14H,1H2,(H,12,13);1H/t2-,3?,4+,5?,7?;/m1./s1 |
| InChIKey | BDAQMBVDLWZCBS-YXNPVRFRSA-N |
| XLogP | -1.68 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.07 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|