C7H11NaO6 — CID 24837051
sodium 1,3,4,5-tetrahydroxycyclohexane-1-carboxylate (PubChem CID 24837051) has the molecular formula C7H11NaO6 and a molecular weight of 214.15 g/mol. Its IUPAC name is sodium 1,3,4,5-tetrahydroxycyclohexane-1-carboxylate.
| Compound Name | sodium 1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 24837051 |
| Molecular Formula | C7H11NaO6 |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | sodium 1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
| SMILES | O=C([O-])C1(O)CC(O)C(O)C(O)C1.[Na+] |
| InChI | InChI=1S/C7H12O6.Na/c8-3-1-7(13,6(11)12)2-4(9)5(3)10;/h3-5,8-10,13H,1-2H2,(H,11,12);/q;+1/p-1 |
| InChIKey | IJMBEMHHCZPEAG-UHFFFAOYSA-M |
| XLogP | -6.65 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | -6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |