C15H24O12 — CID 134536605
trans-(3R,5R)-3,4,5-trihydroxy-1-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]oxymethoxy]cyclohexane-1-carboxylic acid (PubChem CID 134536605) has the molecular formula C15H24O12 and a molecular weight of 396.35 g/mol. Its IUPAC name is trans-(3R,5R)-3,4,5-trihydroxy-1-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]oxymethoxy]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-3,4,5-trihydroxy-1-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]oxymethoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134536605 |
| Molecular Formula | C15H24O12 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | trans-(3R,5R)-3,4,5-trihydroxy-1-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]oxymethoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(OCOC1(C(=O)O)C[C@@H](O)C(O)[C@H](O)C1)C1(O)C[C@@H](O)C(O)[C@H](O)C1 |
| InChI | InChI=1S/C15H24O12/c16-6-1-14(25,2-7(17)10(6)20)13(24)26-5-27-15(12(22)23)3-8(18)11(21)9(19)4-15/h6-11,16-21,25H,1-5H2,(H,22,23)/t6-,7-,8-,9-,10?,11?,14?,15?/m1/s1 |
| InChIKey | ZNDGLMHBXSDNPL-OFLYDILVSA-N |
| XLogP | -4.19 |
| TPSA | 214.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|