C9H14O5 — CID 70020564
(1R,3S,4S,5R)-3-ethenyl-1,4,5-trihydroxycyclohexane-1-carboxylic acid (PubChem CID 70020564) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is (1R,3S,4S,5R)-3-ethenyl-1,4,5-trihydroxycyclohexane-1-carboxylic acid.
| Compound Name | (1R,3S,4S,5R)-3-ethenyl-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 70020564 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (1R,3S,4S,5R)-3-ethenyl-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| SMILES | C=C[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H14O5/c1-2-5-3-9(14,8(12)13)4-6(10)7(5)11/h2,5-7,10-11,14H,1,3-4H2,(H,12,13)/t5-,6-,7+,9-/m1/s1 |
| InChIKey | CPIOGBLNKLTGLL-JAGXHNFQSA-N |
| XLogP | -0.88 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|