C14H20FeO12 — CID 162471969
[(4R,6R)-2,4,5,6-tetrahydroxy-2-[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]peroxycarbonylcyclohexylidene]iron (PubChem CID 162471969) has the molecular formula C14H20FeO12 and a molecular weight of 436.15 g/mol. Its IUPAC name is [(4R,6R)-2,4,5,6-tetrahydroxy-2-[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]peroxycarbonylcyclohexylidene]iron.
| Compound Name | [(4R,6R)-2,4,5,6-tetrahydroxy-2-[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]peroxycarbonylcyclohexylidene]iron |
|---|---|
| PubChem CID | 162471969 |
| Molecular Formula | C14H20FeO12 |
| Molecular Weight | 436.15 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | [(4R,6R)-2,4,5,6-tetrahydroxy-2-[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]peroxycarbonylcyclohexylidene]iron |
| SMILES | O=C(OOC(=O)C1(O)C[C@@H](O)C(O)[C@@H](O)C1=[Fe])C1(O)C[C@@H](O)C(O)[C@H](O)C1 |
| InChI | InChI=1S/C14H20O12.Fe/c15-5-1-13(23,2-6(16)9(5)19)11(21)25-26-12(22)14(24)3-7(17)10(20)8(18)4-14;/h5-10,15-20,23-24H,1-3H2;/t5-,6-,7-,8+,9?,10?,13?,14?;/m1./s1 |
| InChIKey | MTYYTAXIBQFTJZ-GLSYYPIUSA-N |
| XLogP | -5.47 |
| TPSA | 214.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.15 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|