C12H23O8P — CID 10314275
methyl (1S,3S,4R,5R)-3-(2-dimethoxyphosphorylethyl)-1,4,5-trihydroxycyclohexane-1-carboxylate (PubChem CID 10314275) has the molecular formula C12H23O8P and a molecular weight of 326.28 g/mol. Its IUPAC name is methyl (1S,3S,4R,5R)-3-(2-dimethoxyphosphorylethyl)-1,4,5-trihydroxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3S,4R,5R)-3-(2-dimethoxyphosphorylethyl)-1,4,5-trihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10314275 |
| Molecular Formula | C12H23O8P |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | methyl (1S,3S,4R,5R)-3-(2-dimethoxyphosphorylethyl)-1,4,5-trihydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@@H](CCP(=O)(OC)OC)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C12H23O8P/c1-18-11(15)12(16)6-8(10(14)9(13)7-12)4-5-21(17,19-2)20-3/h8-10,13-14,16H,4-7H2,1-3H3/t8-,9-,10-,12+/m1/s1 |
| InChIKey | DWFJWWIRRCWWPZ-BFLSOPEQSA-N |
| XLogP | -0.10 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|