C10H19HgO7S — CID 101197115
(2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxy-2-methoxycarbonyloxane-2-thiolate;mercury(1+);methane (PubChem CID 101197115) has the molecular formula C10H19HgO7S and a molecular weight of 483.91 g/mol. Its IUPAC name is (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxy-2-methoxycarbonyloxane-2-thiolate;mercury(1+);methane.
| Compound Name | (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxy-2-methoxycarbonyloxane-2-thiolate;mercury(1+);methane |
|---|---|
| PubChem CID | 101197115 |
| Molecular Formula | C10H19HgO7S |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxy-2-methoxycarbonyloxane-2-thiolate;mercury(1+);methane |
| SMILES | C.COC(=O)[C@]1([S-])C[C@@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O1.[Hg+] |
| InChI | InChI=1S/C9H16O7S.CH4.Hg/c1-15-8(14)9(17)2-4(11)6(13)7(16-9)5(12)3-10;;/h4-7,10-13,17H,2-3H2,1H3;1H4;/q;;+1/p-1/t4-,5-,6-,7-,9-;;/m1../s1 |
| InChIKey | OXIGVPNQRVHSAW-SLJSFDSFSA-M |
| XLogP | -2.10 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|