About methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate
methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 170280915) has the molecular formula C10H16O7
and a molecular weight of 248.23 g/mol. Its IUPAC name is methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate |
| PubChem CID | 170280915 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | COC(=O)C1(O)CC(O)C2C(O1)C2C(O)CO |
| InChI | InChI=1S/C10H16O7/c1-16-9(14)10(15)2-4(12)6-7(5(13)3-11)8(6)17-10/h4-8,11-13,15H,2-3H2,1H3 |
| InChIKey | VWCNFMZPFFBPLV-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate?
The IUPAC name of methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate (CID 170280915) is methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate.
What is the SMILES notation for methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate?
The canonical SMILES for methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate is COC(=O)C1(O)CC(O)C2C(O1)C2C(O)CO.
What is the InChIKey of methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate?
The InChIKey is VWCNFMZPFFBPLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O7/c1-16-9(14)10(15)2-4(12)6-7(5(13)3-11)8(6)17-10/h4-8,11-13,15H,2-3H2,1H3.
What are the key properties of methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate?
methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate has a molecular weight of 248.23 g/mol, XLogP of -2.40, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-(1,2-dihydroxyethyl)-3,5-dihydroxy-2-oxabicyclo[4.1.0]heptane-3-carboxylate is sourced from PubChem (CID 170280915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).