C11H21NO8 — CID 101118722
methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4,5-dihydroxy-2-methoxyoxane-2-carboxylate (PubChem CID 101118722) has the molecular formula C11H21NO8 and a molecular weight of 295.29 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4,5-dihydroxy-2-methoxyoxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4,5-dihydroxy-2-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 101118722 |
| Molecular Formula | C11H21NO8 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4,5-dihydroxy-2-methoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(OC)C[C@H](O)[C@@H](O)[C@H]([C@H](O)[C@H](O)CN)O1 |
| InChI | InChI=1S/C11H21NO8/c1-18-10(17)11(19-2)3-5(13)7(15)9(20-11)8(16)6(14)4-12/h5-9,13-16H,3-4,12H2,1-2H3/t5-,6+,7+,8+,9+,11+/m0/s1 |
| InChIKey | JCPUIJDCSNMBSI-YRMXFSIDSA-N |
| XLogP | -3.31 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |