C22H32O18 — CID 134482598
trans-(3R,5R)-3,4,5-trihydroxy-1-[[(7R,9R)-7,8,9-trihydroxy-4-oxo-2-[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]oxy-1,3-dioxaspiro[4.5]decan-2-yl]oxy]cyclohexane-1-carboxylic acid (PubChem CID 134482598) has the molecular formula C22H32O18 and a molecular weight of 584.48 g/mol. Its IUPAC name is trans-(3R,5R)-3,4,5-trihydroxy-1-[[(7R,9R)-7,8,9-trihydroxy-4-oxo-2-[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]oxy-1,3-dioxaspiro[4.5]decan-2-yl]oxy]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-3,4,5-trihydroxy-1-[[(7R,9R)-7,8,9-trihydroxy-4-oxo-2-[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]oxy-1,3-dioxaspiro[4.5]decan-2-yl]oxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134482598 |
| Molecular Formula | C22H32O18 |
| Molecular Weight | 584.48 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | trans-(3R,5R)-3,4,5-trihydroxy-1-[[(7R,9R)-7,8,9-trihydroxy-4-oxo-2-[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]oxy-1,3-dioxaspiro[4.5]decan-2-yl]oxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(OC1(OC2(C(=O)O)C[C@@H](O)C(O)[C@H](O)C2)OC(=O)C2(C[C@@H](O)C(O)[C@H](O)C2)O1)C1(O)C[C@@H](O)C(O)[C@H](O)C1 |
| InChI | InChI=1S/C22H32O18/c23-7-1-19(36,2-8(24)13(7)29)17(34)37-22(39-20(16(32)33)3-9(25)14(30)10(26)4-20)38-18(35)21(40-22)5-11(27)15(31)12(28)6-21/h7-15,23-31,36H,1-6H2,(H,32,33)/t7-,8-,9-,10-,11-,12-,13?,14?,15?,19?,20?,21?,22?/m1/s1 |
| InChIKey | MKEADDLFNRUURQ-IEYRKJRYSA-N |
| XLogP | -6.35 |
| TPSA | 310.66 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.48 |
| LogP ≤ 5 | -6.35 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|