C22H20O8 — CID 11361935
trans-(5,8-dioxoanthracen-2-yl)methyl (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate (PubChem CID 11361935) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is trans-(5,8-dioxoanthracen-2-yl)methyl (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate.
| Compound Name | trans-(5,8-dioxoanthracen-2-yl)methyl (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11361935 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | trans-(5,8-dioxoanthracen-2-yl)methyl (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
| SMILES | O=C1C=CC(=O)c2cc3cc(COC(=O)C4(O)C[C@@H](O)C(O)[C@H](O)C4)ccc3cc21 |
| InChI | InChI=1S/C22H20O8/c23-16-3-4-17(24)15-7-13-5-11(1-2-12(13)6-14(15)16)10-30-21(28)22(29)8-18(25)20(27)19(26)9-22/h1-7,18-20,25-27,29H,8-10H2/t18-,19-,20?,22?/m1/s1 |
| InChIKey | MJSRKOHDPIOMOF-NDUMYTTKSA-N |
| XLogP | 0.43 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|