C15H10O3 — CID 70804223
6-methoxyanthracene-1,4-dione (PubChem CID 70804223) has the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. Its IUPAC name is 6-methoxyanthracene-1,4-dione.
| Compound Name | 6-methoxyanthracene-1,4-dione |
|---|---|
| PubChem CID | 70804223 |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 6-methoxyanthracene-1,4-dione |
| SMILES | COc1ccc2cc3c(cc2c1)C(=O)C=CC3=O |
| InChI | InChI=1S/C15H10O3/c1-18-11-3-2-9-7-12-13(8-10(9)6-11)15(17)5-4-14(12)16/h2-8H,1H3 |
| InChIKey | LLXRQEMLMJDRGK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|