About 6-(hydroxymethyl)anthracene-1,4-dione;propane
6-(hydroxymethyl)anthracene-1,4-dione;propane (PubChem CID 143165069) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is 6-(hydroxymethyl)anthracene-1,4-dione;propane.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)anthracene-1,4-dione;propane |
| PubChem CID | 143165069 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 6-(hydroxymethyl)anthracene-1,4-dione;propane |
| SMILES | CCC.O=C1C=CC(=O)c2cc3cc(CO)ccc3cc21 |
| InChI | InChI=1S/C15H10O3.C3H8/c16-8-9-1-2-10-6-12-13(7-11(10)5-9)15(18)4-3-14(12)17;1-3-2/h1-7,16H,8H2;3H2,1-2H3 |
| InChIKey | UXGYVUZNVYHTOZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6-(hydroxymethyl)anthracene-1,4-dione;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)anthracene-1,4-dione;propane?
The IUPAC name of 6-(hydroxymethyl)anthracene-1,4-dione;propane (CID 143165069) is 6-(hydroxymethyl)anthracene-1,4-dione;propane.
What is the SMILES notation for 6-(hydroxymethyl)anthracene-1,4-dione;propane?
The canonical SMILES for 6-(hydroxymethyl)anthracene-1,4-dione;propane is CCC.O=C1C=CC(=O)c2cc3cc(CO)ccc3cc21.
What is the InChIKey of 6-(hydroxymethyl)anthracene-1,4-dione;propane?
The InChIKey is UXGYVUZNVYHTOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O3.C3H8/c16-8-9-1-2-10-6-12-13(7-11(10)5-9)15(18)4-3-14(12)17;1-3-2/h1-7,16H,8H2;3H2,1-2H3.
What are the key properties of 6-(hydroxymethyl)anthracene-1,4-dione;propane?
6-(hydroxymethyl)anthracene-1,4-dione;propane has a molecular weight of 282.34 g/mol, XLogP of 3.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)anthracene-1,4-dione;propane is sourced from PubChem (CID 143165069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).