C7H8O8-2 — CID 134820509
(2S,4R,5R,6S)-2,4,5-trihydroxyoxane-2,6-dicarboxylate (PubChem CID 134820509) has the molecular formula C7H8O8-2 and a molecular weight of 220.13 g/mol. Its IUPAC name is (2S,4R,5R,6S)-2,4,5-trihydroxyoxane-2,6-dicarboxylate.
| Compound Name | (2S,4R,5R,6S)-2,4,5-trihydroxyoxane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 134820509 |
| Molecular Formula | C7H8O8-2 |
| Molecular Weight | 220.13 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | (2S,4R,5R,6S)-2,4,5-trihydroxyoxane-2,6-dicarboxylate |
| SMILES | O=C([O-])[C@H]1O[C@](O)(C(=O)[O-])C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H10O8/c8-2-1-7(14,6(12)13)15-4(3(2)9)5(10)11/h2-4,8-9,14H,1H2,(H,10,11)(H,12,13)/p-2/t2-,3-,4+,7+/m1/s1 |
| InChIKey | ZJDMTWUYUXJUEE-MDASVERJSA-L |
| XLogP | -5.31 |
| TPSA | 150.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.13 |
| LogP ≤ 5 | -5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |