C17H28 — CID 134976819
(1R,2S,5R)-6,6-dimethyl-2-oct-2-ynylbicyclo[3.1.1]heptane (PubChem CID 134976819) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is (1R,2S,5R)-6,6-dimethyl-2-oct-2-ynylbicyclo[3.1.1]heptane.
| Compound Name | (1R,2S,5R)-6,6-dimethyl-2-oct-2-ynylbicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 134976819 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | (1R,2S,5R)-6,6-dimethyl-2-oct-2-ynylbicyclo[3.1.1]heptane |
| SMILES | CCCCCC#CC[C@@H]1CC[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C17H28/c1-4-5-6-7-8-9-10-14-11-12-15-13-16(14)17(15,2)3/h14-16H,4-7,10-13H2,1-3H3/t14-,15-,16-/m1/s1 |
| InChIKey | SHZOTIJGKMPUBY-BZUAXINKSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|