C31H31ClNO4P — CID 134976906
methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-3-phenylpropanoate (PubChem CID 134976906) has the molecular formula C31H31ClNO4P and a molecular weight of 548.02 g/mol. Its IUPAC name is methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 134976906 |
| Molecular Formula | C31H31ClNO4P |
| Molecular Weight | 548.02 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | methyl 2-[2-[chloro(triphenyl)-λ5-phosphanyl]ethoxycarbonylamino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)OCCP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H31ClNO4P/c1-36-30(34)29(24-25-14-6-2-7-15-25)33-31(35)37-22-23-38(32,26-16-8-3-9-17-26,27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-21,29H,22-24H2,1H3,(H,33,35) |
| InChIKey | KDUXMMRXCAVZPB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.02 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|