C21H19BrIN2O2P — CID 134977056
2-[bromo(triphenyl)-λ5-phosphanyl]-N-carbamoyl-2-iodoacetamide (PubChem CID 134977056) has the molecular formula C21H19BrIN2O2P and a molecular weight of 569.18 g/mol. Its IUPAC name is 2-[bromo(triphenyl)-λ5-phosphanyl]-N-carbamoyl-2-iodoacetamide.
| Compound Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-N-carbamoyl-2-iodoacetamide |
|---|---|
| PubChem CID | 134977056 |
| Molecular Formula | C21H19BrIN2O2P |
| Molecular Weight | 569.18 g/mol |
| Exact Mass | 567.94 |
| IUPAC Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-N-carbamoyl-2-iodoacetamide |
| SMILES | NC(=O)NC(=O)C(I)P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19BrIN2O2P/c22-28(16-10-4-1-5-11-16,17-12-6-2-7-13-17,18-14-8-3-9-15-18)19(23)20(26)25-21(24)27/h1-15,19H,(H3,24,25,26,27) |
| InChIKey | CROHWFUSAPTLPW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.18 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|