About bicyclo[9.4.0]pentadeca-2,9-diyne
bicyclo[9.4.0]pentadeca-2,9-diyne (PubChem CID 134978450) has the molecular formula C15H20
and a molecular weight of 200.32 g/mol. Its IUPAC name is bicyclo[9.4.0]pentadeca-2,9-diyne.
Molecular Properties
| Compound Name | bicyclo[9.4.0]pentadeca-2,9-diyne |
| PubChem CID | 134978450 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | bicyclo[9.4.0]pentadeca-2,9-diyne |
| SMILES | C1#CC2CCCCC2C#CCCCCC1 |
| InChI | InChI=1S/C15H20/c1-2-4-6-10-14-12-8-9-13-15(14)11-7-5-3-1/h14-15H,1-5,8-9,12-13H2 |
| InChIKey | CEGUPSUTAWJEDQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[9.4.0]pentadeca-2,9-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[9.4.0]pentadeca-2,9-diyne?
The IUPAC name of bicyclo[9.4.0]pentadeca-2,9-diyne (CID 134978450) is bicyclo[9.4.0]pentadeca-2,9-diyne.
What is the SMILES notation for bicyclo[9.4.0]pentadeca-2,9-diyne?
The canonical SMILES for bicyclo[9.4.0]pentadeca-2,9-diyne is C1#CC2CCCCC2C#CCCCCC1.
What is the InChIKey of bicyclo[9.4.0]pentadeca-2,9-diyne?
The InChIKey is CEGUPSUTAWJEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20/c1-2-4-6-10-14-12-8-9-13-15(14)11-7-5-3-1/h14-15H,1-5,8-9,12-13H2.
What are the key properties of bicyclo[9.4.0]pentadeca-2,9-diyne?
bicyclo[9.4.0]pentadeca-2,9-diyne has a molecular weight of 200.32 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[9.4.0]pentadeca-2,9-diyne is sourced from PubChem (CID 134978450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).