C13H22O2 — CID 134978645
(1R,5R,8S,9R)-9-methyltricyclo[6.3.1.01,5]dodecane-8,9-diol (PubChem CID 134978645) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (1R,5R,8S,9R)-9-methyltricyclo[6.3.1.01,5]dodecane-8,9-diol.
| Compound Name | (1R,5R,8S,9R)-9-methyltricyclo[6.3.1.01,5]dodecane-8,9-diol |
|---|---|
| PubChem CID | 134978645 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (1R,5R,8S,9R)-9-methyltricyclo[6.3.1.01,5]dodecane-8,9-diol |
| SMILES | C[C@@]1(O)CC[C@@]23CCC[C@@H]2CC[C@]1(O)C3 |
| InChI | InChI=1S/C13H22O2/c1-11(14)7-8-12-5-2-3-10(12)4-6-13(11,15)9-12/h10,14-15H,2-9H2,1H3/t10-,11-,12-,13+/m1/s1 |
| InChIKey | ZDVLYFCYYNNWSL-LPWJVIDDSA-N |
| XLogP | 2.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |