C20H34O2 — CID 14845624
2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadecane-12,13-diol (PubChem CID 14845624) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadecane-12,13-diol.
| Compound Name | 2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadecane-12,13-diol |
|---|---|
| PubChem CID | 14845624 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadecane-12,13-diol |
| SMILES | CC1(C)CCCC2(C)C1CCC1CC3(O)CC12CCC3(C)O |
| InChI | InChI=1S/C20H34O2/c1-16(2)8-5-9-17(3)15(16)7-6-14-12-20(22)13-19(14,17)11-10-18(20,4)21/h14-15,21-22H,5-13H2,1-4H3 |
| InChIKey | JACPJMMFBVQTHJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |