C20H34O2 — CID 90662481
(1R,2S,6S,10S,12R,13S)-6-(hydroxymethyl)-2,6,13-trimethyltetracyclo[10.3.1.01,10.02,7]hexadecan-13-ol (PubChem CID 90662481) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1R,2S,6S,10S,12R,13S)-6-(hydroxymethyl)-2,6,13-trimethyltetracyclo[10.3.1.01,10.02,7]hexadecan-13-ol.
| Compound Name | (1R,2S,6S,10S,12R,13S)-6-(hydroxymethyl)-2,6,13-trimethyltetracyclo[10.3.1.01,10.02,7]hexadecan-13-ol |
|---|---|
| PubChem CID | 90662481 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1R,2S,6S,10S,12R,13S)-6-(hydroxymethyl)-2,6,13-trimethyltetracyclo[10.3.1.01,10.02,7]hexadecan-13-ol |
| SMILES | C[C@]1(CO)CCC[C@@]2(C)C1CC[C@H]1C[C@@H]3C[C@]12CC[C@]3(C)O |
| InChI | InChI=1S/C20H34O2/c1-17(13-21)7-4-8-18(2)16(17)6-5-14-11-15-12-20(14,18)10-9-19(15,3)22/h14-16,21-22H,4-13H2,1-3H3/t14-,15+,16?,17+,18-,19-,20+/m0/s1 |
| InChIKey | YFPSFADPQXOJFU-MDQPBSSCSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |