C33H43NO3 — CID 101114149
[(1R,2S,4S,7S,10S,12S,13S)-13-hydroxy-2,6,6,13-tetramethyl-4-tetracyclo[10.3.1.01,10.02,7]hexadecanyl] N,N-diphenylcarbamate (PubChem CID 101114149) has the molecular formula C33H43NO3 and a molecular weight of 501.71 g/mol. Its IUPAC name is [(1R,2S,4S,7S,10S,12S,13S)-13-hydroxy-2,6,6,13-tetramethyl-4-tetracyclo[10.3.1.01,10.02,7]hexadecanyl] N,N-diphenylcarbamate.
| Compound Name | [(1R,2S,4S,7S,10S,12S,13S)-13-hydroxy-2,6,6,13-tetramethyl-4-tetracyclo[10.3.1.01,10.02,7]hexadecanyl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 101114149 |
| Molecular Formula | C33H43NO3 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | [(1R,2S,4S,7S,10S,12S,13S)-13-hydroxy-2,6,6,13-tetramethyl-4-tetracyclo[10.3.1.01,10.02,7]hexadecanyl] N,N-diphenylcarbamate |
| SMILES | CC1(C)C[C@H](OC(=O)N(c2ccccc2)c2ccccc2)C[C@@]2(C)[C@H]1CC[C@H]1C[C@H]3C[C@]12CC[C@]3(C)O |
| InChI | InChI=1S/C33H43NO3/c1-30(2)21-27(37-29(35)34(25-11-7-5-8-12-25)26-13-9-6-10-14-26)22-31(3)28(30)16-15-23-19-24-20-33(23,31)18-17-32(24,4)36/h5-14,23-24,27-28,36H,15-22H2,1-4H3/t23-,24-,27-,28-,31-,32-,33+/m0/s1 |
| InChIKey | FEHHEMCZXBSNRE-MOPWXPEFSA-N |
| XLogP | 8.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |