C24H40O3 — CID 101114146
[(1R,2S,4S,7S,10S,12S,13S)-13-hydroxy-2,6,6,13-tetramethyl-4-tetracyclo[10.3.1.01,10.02,7]hexadecanyl] 2-methylpropanoate (PubChem CID 101114146) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is [(1R,2S,4S,7S,10S,12S,13S)-13-hydroxy-2,6,6,13-tetramethyl-4-tetracyclo[10.3.1.01,10.02,7]hexadecanyl] 2-methylpropanoate.
| Compound Name | [(1R,2S,4S,7S,10S,12S,13S)-13-hydroxy-2,6,6,13-tetramethyl-4-tetracyclo[10.3.1.01,10.02,7]hexadecanyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 101114146 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | [(1R,2S,4S,7S,10S,12S,13S)-13-hydroxy-2,6,6,13-tetramethyl-4-tetracyclo[10.3.1.01,10.02,7]hexadecanyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1CC(C)(C)[C@@H]2CC[C@H]3C[C@H]4C[C@@]3(CC[C@]4(C)O)[C@@]2(C)C1 |
| InChI | InChI=1S/C24H40O3/c1-15(2)20(25)27-18-13-21(3,4)19-8-7-16-11-17-12-24(16,22(19,5)14-18)10-9-23(17,6)26/h15-19,26H,7-14H2,1-6H3/t16-,17-,18-,19-,22-,23-,24+/m0/s1 |
| InChIKey | QEKMHFXTDGQZIG-OYZXLFCSSA-N |
| XLogP | 5.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |