C22H38ClNO5 — CID 10388065
methyl 2-[[(1S,2S,5R,6R,7R,10S,13R)-5,13-dihydroxy-6-(hydroxymethyl)-2,6-dimethyl-13-tetracyclo[10.3.1.01,10.02,7]hexadecanyl]amino]acetate;hydrochloride (PubChem CID 10388065) has the molecular formula C22H38ClNO5 and a molecular weight of 432.00 g/mol. Its IUPAC name is methyl 2-[[(1S,2S,5R,6R,7R,10S,13R)-5,13-dihydroxy-6-(hydroxymethyl)-2,6-dimethyl-13-tetracyclo[10.3.1.01,10.02,7]hexadecanyl]amino]acetate;hydrochloride.
| Compound Name | methyl 2-[[(1S,2S,5R,6R,7R,10S,13R)-5,13-dihydroxy-6-(hydroxymethyl)-2,6-dimethyl-13-tetracyclo[10.3.1.01,10.02,7]hexadecanyl]amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 10388065 |
| Molecular Formula | C22H38ClNO5 |
| Molecular Weight | 432.00 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | methyl 2-[[(1S,2S,5R,6R,7R,10S,13R)-5,13-dihydroxy-6-(hydroxymethyl)-2,6-dimethyl-13-tetracyclo[10.3.1.01,10.02,7]hexadecanyl]amino]acetate;hydrochloride |
| SMILES | COC(=O)CN[C@@]1(O)CC[C@]23CC1C[C@@H]2CC[C@H]1[C@](C)(CO)[C@H](O)CC[C@@]13C.Cl |
| InChI | InChI=1S/C22H37NO5.ClH/c1-19(13-24)16-5-4-14-10-15-11-21(14,20(16,2)7-6-17(19)25)8-9-22(15,27)23-12-18(26)28-3;/h14-17,23-25,27H,4-13H2,1-3H3;1H/t14-,15?,16-,17+,19-,20-,21-,22+;/m0./s1 |
| InChIKey | COKMALTVQMZFDH-UNNRPYEVSA-N |
| XLogP | 2.24 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.00 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|