About (3,3-difluorocyclopentyl) 2-methylpropanoate
(3,3-difluorocyclopentyl) 2-methylpropanoate (PubChem CID 155710616) has the molecular formula C9H14F2O2
and a molecular weight of 192.20 g/mol. Its IUPAC name is (3,3-difluorocyclopentyl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (3,3-difluorocyclopentyl) 2-methylpropanoate |
| PubChem CID | 155710616 |
| Molecular Formula | C9H14F2O2 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (3,3-difluorocyclopentyl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H14F2O2/c1-6(2)8(12)13-7-3-4-9(10,11)5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | OJFVFZPDNRMVGI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,3-difluorocyclopentyl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluorocyclopentyl) 2-methylpropanoate?
The IUPAC name of (3,3-difluorocyclopentyl) 2-methylpropanoate (CID 155710616) is (3,3-difluorocyclopentyl) 2-methylpropanoate.
What is the SMILES notation for (3,3-difluorocyclopentyl) 2-methylpropanoate?
The canonical SMILES for (3,3-difluorocyclopentyl) 2-methylpropanoate is CC(C)C(=O)OC1CCC(F)(F)C1.
What is the InChIKey of (3,3-difluorocyclopentyl) 2-methylpropanoate?
The InChIKey is OJFVFZPDNRMVGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O2/c1-6(2)8(12)13-7-3-4-9(10,11)5-7/h6-7H,3-5H2,1-2H3.
What are the key properties of (3,3-difluorocyclopentyl) 2-methylpropanoate?
(3,3-difluorocyclopentyl) 2-methylpropanoate has a molecular weight of 192.20 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluorocyclopentyl) 2-methylpropanoate is sourced from PubChem (CID 155710616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).