About [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate
[(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate (PubChem CID 18442884) has the molecular formula C14H16F2O3
and a molecular weight of 270.27 g/mol. Its IUPAC name is [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate.
Molecular Properties
| Compound Name | [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate |
| PubChem CID | 18442884 |
| Molecular Formula | C14H16F2O3 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc([C@@H](O)C(=O)O[C@@H]2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C14H16F2O3/c1-9-2-4-10(5-3-9)12(17)13(18)19-11-6-7-14(15,16)8-11/h2-5,11-12,17H,6-8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | UZMQJTNGXFKPLP-VXGBXAGGSA-N |
| XLogP | 2.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate?
The IUPAC name of [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate (CID 18442884) is [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate.
What is the SMILES notation for [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate?
The canonical SMILES for [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate is Cc1ccc([C@@H](O)C(=O)O[C@@H]2CCC(F)(F)C2)cc1.
What is the InChIKey of [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate?
The InChIKey is UZMQJTNGXFKPLP-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H16F2O3/c1-9-2-4-10(5-3-9)12(17)13(18)19-11-6-7-14(15,16)8-11/h2-5,11-12,17H,6-8H2,1H3/t11-,12-/m1/s1.
What are the key properties of [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate?
[(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate has a molecular weight of 270.27 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-3,3-difluorocyclopentyl] (2R)-2-hydroxy-2-(4-methylphenyl)acetate is sourced from PubChem (CID 18442884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).