C13H19F2NO3S — CID 138684438
(1S)-3,3-difluorocyclohexan-1-amine;4-methylbenzenesulfonic acid (PubChem CID 138684438) has the molecular formula C13H19F2NO3S and a molecular weight of 307.36 g/mol. Its IUPAC name is (1S)-3,3-difluorocyclohexan-1-amine;4-methylbenzenesulfonic acid.
| Compound Name | (1S)-3,3-difluorocyclohexan-1-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 138684438 |
| Molecular Formula | C13H19F2NO3S |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (1S)-3,3-difluorocyclohexan-1-amine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N[C@H]1CCCC(F)(F)C1 |
| InChI | InChI=1S/C7H8O3S.C6H11F2N/c1-6-2-4-7(5-3-6)11(8,9)10;7-6(8)3-1-2-5(9)4-6/h2-5H,1H3,(H,8,9,10);5H,1-4,9H2/t;5-/m.0/s1 |
| InChIKey | CCUBROMAXKJYDM-ZSCHJXSPSA-N |
| XLogP | 2.76 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|