About 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid)
1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid) (PubChem CID 22313334) has the molecular formula C22H32N2O6S2
and a molecular weight of 484.64 g/mol. Its IUPAC name is 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid).
Molecular Properties
| Compound Name | 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid) |
| PubChem CID | 22313334 |
| Molecular Formula | C22H32N2O6S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid) |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.NC1CC2CCN(CC2)C1 |
| InChI | InChI=1S/C8H16N2.2C7H8O3S/c9-8-5-7-1-3-10(6-8)4-2-7;2*1-6-2-4-7(5-3-6)11(8,9)10/h7-8H,1-6,9H2;2*2-5H,1H3,(H,8,9,10) |
| InChIKey | WOVRTYYYRIRFPW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid)?
The IUPAC name of 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid) (CID 22313334) is 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid).
What is the SMILES notation for 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid)?
The canonical SMILES for 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid) is Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.NC1CC2CCN(CC2)C1.
What is the InChIKey of 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid)?
The InChIKey is WOVRTYYYRIRFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.2C7H8O3S/c9-8-5-7-1-3-10(6-8)4-2-7;2*1-6-2-4-7(5-3-6)11(8,9)10/h7-8H,1-6,9H2;2*2-5H,1H3,(H,8,9,10).
What are the key properties of 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid)?
1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid) has a molecular weight of 484.64 g/mol, XLogP of 2.91, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[3.2.2]nonan-3-amine;bis(4-methylbenzenesulfonic acid) is sourced from PubChem (CID 22313334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).