C15H18F2O3 — CID 18442883
(3,3-difluorocyclopentyl) 2-(4-ethylphenyl)-2-hydroxyacetate (PubChem CID 18442883) has the molecular formula C15H18F2O3 and a molecular weight of 284.30 g/mol. Its IUPAC name is (3,3-difluorocyclopentyl) 2-(4-ethylphenyl)-2-hydroxyacetate.
| Compound Name | (3,3-difluorocyclopentyl) 2-(4-ethylphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 18442883 |
| Molecular Formula | C15H18F2O3 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (3,3-difluorocyclopentyl) 2-(4-ethylphenyl)-2-hydroxyacetate |
| SMILES | CCc1ccc(C(O)C(=O)OC2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C15H18F2O3/c1-2-10-3-5-11(6-4-10)13(18)14(19)20-12-7-8-15(16,17)9-12/h3-6,12-13,18H,2,7-9H2,1H3 |
| InChIKey | JXQFLCNLCGBHRN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |