C20H32 — CID 15907362
(1S,2S,7S,10S,12R)-2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadec-13-ene (PubChem CID 15907362) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1S,2S,7S,10S,12R)-2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadec-13-ene.
| Compound Name | (1S,2S,7S,10S,12R)-2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadec-13-ene |
|---|---|
| PubChem CID | 15907362 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1S,2S,7S,10S,12R)-2,6,6,13-tetramethyltetracyclo[10.3.1.01,10.02,7]hexadec-13-ene |
| SMILES | CC1=CC[C@]23C[C@H]1C[C@@H]2CC[C@H]1C(C)(C)CCC[C@@]13C |
| InChI | InChI=1S/C20H32/c1-14-8-11-20-13-15(14)12-16(20)6-7-17-18(2,3)9-5-10-19(17,20)4/h8,15-17H,5-7,9-13H2,1-4H3/t15-,16+,17+,19+,20+/m1/s1 |
| InChIKey | OQLQRDAXEXXZKZ-ORZNMBHWSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|